C24H21F3N4O — CID 130405161
N-[3-[5-cyano-6-(propylamino)-3-pyridinyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 130405161) has the molecular formula C24H21F3N4O and a molecular weight of 438.45 g/mol. Its IUPAC name is N-[3-[5-cyano-6-(propylamino)-3-pyridinyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[5-cyano-6-(propylamino)-3-pyridinyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130405161 |
| Molecular Formula | C24H21F3N4O |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-[3-[5-cyano-6-(propylamino)-3-pyridinyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCCNc1ncc(-c2cc(NC(=O)c3cccc(C(F)(F)F)c3)ccc2C)cc1C#N |
| InChI | InChI=1S/C24H21F3N4O/c1-3-9-29-22-17(13-28)10-18(14-30-22)21-12-20(8-7-15(21)2)31-23(32)16-5-4-6-19(11-16)24(25,26)27/h4-8,10-12,14H,3,9H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | QSBFYVNJXJICSJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |