C16H11F3N2O2S — CID 11864207
N-[3-cyano-4-[(R)-methylsulfinyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 11864207) has the molecular formula C16H11F3N2O2S and a molecular weight of 352.34 g/mol. Its IUPAC name is N-[3-cyano-4-[(R)-methylsulfinyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-cyano-4-[(R)-methylsulfinyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 11864207 |
| Molecular Formula | C16H11F3N2O2S |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | N-[3-cyano-4-[(R)-methylsulfinyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | C[S@@](=O)c1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1C#N |
| InChI | InChI=1S/C16H11F3N2O2S/c1-24(23)14-6-5-13(8-11(14)9-20)21-15(22)10-3-2-4-12(7-10)16(17,18)19/h2-8H,1H3,(H,21,22)/t24-/m1/s1 |
| InChIKey | YYISMIRYLIQPGG-XMMPIXPASA-N |
| XLogP | 3.57 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |