C15H12F3NO2S — CID 51191508
4-methylsulfinyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 51191508) has the molecular formula C15H12F3NO2S and a molecular weight of 327.33 g/mol. Its IUPAC name is 4-methylsulfinyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-methylsulfinyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 51191508 |
| Molecular Formula | C15H12F3NO2S |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 4-methylsulfinyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CS(=O)c1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H12F3NO2S/c1-22(21)13-7-5-10(6-8-13)14(20)19-12-4-2-3-11(9-12)15(16,17)18/h2-9H,1H3,(H,19,20) |
| InChIKey | GHDDJLKPQGTENN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |