C27H31BFN3O3 — CID 169024567
2-(2-fluoropropan-2-yl)-N-[6-methyl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide (PubChem CID 169024567) has the molecular formula C27H31BFN3O3 and a molecular weight of 475.37 g/mol. Its IUPAC name is 2-(2-fluoropropan-2-yl)-N-[6-methyl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-fluoropropan-2-yl)-N-[6-methyl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 169024567 |
| Molecular Formula | C27H31BFN3O3 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 2-(2-fluoropropan-2-yl)-N-[6-methyl-5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]pyridine-4-carboxamide |
| SMILES | Cc1ncc(NC(=O)c2ccnc(C(C)(C)F)c2)cc1-c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C27H31BFN3O3/c1-17-22(18-9-8-10-20(13-18)28-34-26(4,5)27(6,7)35-28)15-21(16-31-17)32-24(33)19-11-12-30-23(14-19)25(2,3)29/h8-16H,1-7H3,(H,32,33) |
| InChIKey | OLRSPKMAMUZIMH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|