C15H22BNO5 — CID 171869200
2,3-dihydroxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide (PubChem CID 171869200) has the molecular formula C15H22BNO5 and a molecular weight of 307.16 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide.
| Compound Name | 2,3-dihydroxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 171869200 |
| Molecular Formula | C15H22BNO5 |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2,3-dihydroxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
| SMILES | CC1(C)OB(c2ccc(C(O)C(O)C(N)=O)cc2)OC1(C)C |
| InChI | InChI=1S/C15H22BNO5/c1-14(2)15(3,4)22-16(21-14)10-7-5-9(6-8-10)11(18)12(19)13(17)20/h5-8,11-12,18-19H,1-4H3,(H2,17,20) |
| InChIKey | JLCOWYFQOKOECJ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|