C22H32BF4NO4 — CID 68776630
ethyl (2R)-4-fluoro-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]pentanoate (PubChem CID 68776630) has the molecular formula C22H32BF4NO4 and a molecular weight of 461.31 g/mol. Its IUPAC name is ethyl (2R)-4-fluoro-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]pentanoate.
| Compound Name | ethyl (2R)-4-fluoro-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]pentanoate |
|---|---|
| PubChem CID | 68776630 |
| Molecular Formula | C22H32BF4NO4 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | ethyl (2R)-4-fluoro-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]pentanoate |
| SMILES | CCOC(=O)[C@@H](CC(C)(C)F)N[C@@H](c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H32BF4NO4/c1-8-30-18(29)16(13-19(2,3)24)28-17(22(25,26)27)14-9-11-15(12-10-14)23-31-20(4,5)21(6,7)32-23/h9-12,16-17,28H,8,13H2,1-7H3/t16-,17+/m1/s1 |
| InChIKey | JWNRBMARSUFBOB-SJORKVTESA-N |
| XLogP | 4.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|