C25H24F4N2O3 — CID 68777602
(2S)-4-fluoro-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-[4-(1-oxidopyridin-1-ium-4-yl)phenyl]phenyl]ethyl]amino]pentanoic acid (PubChem CID 68777602) has the molecular formula C25H24F4N2O3 and a molecular weight of 476.47 g/mol. Its IUPAC name is (2S)-4-fluoro-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-[4-(1-oxidopyridin-1-ium-4-yl)phenyl]phenyl]ethyl]amino]pentanoic acid.
| Compound Name | (2S)-4-fluoro-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-[4-(1-oxidopyridin-1-ium-4-yl)phenyl]phenyl]ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 68777602 |
| Molecular Formula | C25H24F4N2O3 |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (2S)-4-fluoro-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-[4-(1-oxidopyridin-1-ium-4-yl)phenyl]phenyl]ethyl]amino]pentanoic acid |
| SMILES | CC(C)(F)C[C@H](N[C@@H](c1ccc(-c2ccc(-c3cc[n+]([O-])cc3)cc2)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C25H24F4N2O3/c1-24(2,26)15-21(23(32)33)30-22(25(27,28)29)20-9-7-17(8-10-20)16-3-5-18(6-4-16)19-11-13-31(34)14-12-19/h3-14,21-22,30H,15H2,1-2H3,(H,32,33)/t21-,22-/m0/s1 |
| InChIKey | DJCZQVRFKQFQRJ-VXKWHMMOSA-N |
| XLogP | 5.44 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|