C24H36BF3N2O3S — CID 169304623
(4S)-4-[1-(2,2-dimethylpropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-5,5,5-trifluoropentane-2-sulfinamide (PubChem CID 169304623) has the molecular formula C24H36BF3N2O3S and a molecular weight of 500.44 g/mol. Its IUPAC name is (4S)-4-[1-(2,2-dimethylpropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-5,5,5-trifluoropentane-2-sulfinamide.
| Compound Name | (4S)-4-[1-(2,2-dimethylpropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-5,5,5-trifluoropentane-2-sulfinamide |
|---|---|
| PubChem CID | 169304623 |
| Molecular Formula | C24H36BF3N2O3S |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | (4S)-4-[1-(2,2-dimethylpropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]-5,5,5-trifluoropentane-2-sulfinamide |
| SMILES | CC(C[C@@H](c1cn(CC(C)(C)C)c2cc(B3OC(C)(C)C(C)(C)O3)ccc12)C(F)(F)F)S(N)=O |
| InChI | InChI=1S/C24H36BF3N2O3S/c1-15(34(29)31)11-19(24(26,27)28)18-13-30(14-21(2,3)4)20-12-16(9-10-17(18)20)25-32-22(5,6)23(7,8)33-25/h9-10,12-13,15,19H,11,14,29H2,1-8H3/t15?,19-,34?/m0/s1 |
| InChIKey | FIAVNDYRPVZCKM-ISPPKBEDSA-N |
| XLogP | 5.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|