C26H27BClNO4S — CID 68976694
2-[1-[(5-chloro-1-benzothiophen-3-yl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]propanoic acid (PubChem CID 68976694) has the molecular formula C26H27BClNO4S and a molecular weight of 495.84 g/mol. Its IUPAC name is 2-[1-[(5-chloro-1-benzothiophen-3-yl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]propanoic acid.
| Compound Name | 2-[1-[(5-chloro-1-benzothiophen-3-yl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 68976694 |
| Molecular Formula | C26H27BClNO4S |
| Molecular Weight | 495.84 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-[1-[(5-chloro-1-benzothiophen-3-yl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]propanoic acid |
| SMILES | CC(C(=O)O)c1cn(Cc2csc3ccc(Cl)cc23)c2cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C26H27BClNO4S/c1-15(24(30)31)21-13-29(12-16-14-34-23-9-7-18(28)11-20(16)23)22-10-17(6-8-19(21)22)27-32-25(2,3)26(4,5)33-27/h6-11,13-15H,12H2,1-5H3,(H,30,31) |
| InChIKey | KQEAOXRXYPNYFW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.84 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|