C12H12ClNOS — CID 67581521
2-(5-chloro-1-benzothiophen-3-yl)-N-ethylacetamide (PubChem CID 67581521) has the molecular formula C12H12ClNOS and a molecular weight of 253.75 g/mol. Its IUPAC name is 2-(5-chloro-1-benzothiophen-3-yl)-N-ethylacetamide.
| Compound Name | 2-(5-chloro-1-benzothiophen-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 67581521 |
| Molecular Formula | C12H12ClNOS |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-(5-chloro-1-benzothiophen-3-yl)-N-ethylacetamide |
| SMILES | CCNC(=O)Cc1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C12H12ClNOS/c1-2-14-12(15)5-8-7-16-11-4-3-9(13)6-10(8)11/h3-4,6-7H,2,5H2,1H3,(H,14,15) |
| InChIKey | HGICLNORMFGKME-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |