C20H20ClNOS — CID 2732812
4-tert-butyl-N-[(5-chloro-1-benzothiophen-3-yl)methyl]benzamide (PubChem CID 2732812) has the molecular formula C20H20ClNOS and a molecular weight of 357.91 g/mol. Its IUPAC name is 4-tert-butyl-N-[(5-chloro-1-benzothiophen-3-yl)methyl]benzamide.
| Compound Name | 4-tert-butyl-N-[(5-chloro-1-benzothiophen-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 2732812 |
| Molecular Formula | C20H20ClNOS |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-tert-butyl-N-[(5-chloro-1-benzothiophen-3-yl)methyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCc2csc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C20H20ClNOS/c1-20(2,3)15-6-4-13(5-7-15)19(23)22-11-14-12-24-18-9-8-16(21)10-17(14)18/h4-10,12H,11H2,1-3H3,(H,22,23) |
| InChIKey | DVAHFIUSKNUXPV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |