C16H18ClNO3S — CID 120522433
6-[[2-(5-chloro-1-benzothiophen-3-yl)acetyl]amino]hexanoic acid (PubChem CID 120522433) has the molecular formula C16H18ClNO3S and a molecular weight of 339.84 g/mol. Its IUPAC name is 6-[[2-(5-chloro-1-benzothiophen-3-yl)acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(5-chloro-1-benzothiophen-3-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120522433 |
| Molecular Formula | C16H18ClNO3S |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 6-[[2-(5-chloro-1-benzothiophen-3-yl)acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)Cc1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H18ClNO3S/c17-12-5-6-14-13(9-12)11(10-22-14)8-15(19)18-7-3-1-2-4-16(20)21/h5-6,9-10H,1-4,7-8H2,(H,18,19)(H,20,21) |
| InChIKey | NCZNUSNHYVVGPY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|