C18H12ClNO2S — CID 90955606
N-(1-benzofuran-2-yl)-2-(5-chloro-1-benzothiophen-3-yl)acetamide (PubChem CID 90955606) has the molecular formula C18H12ClNO2S and a molecular weight of 341.82 g/mol. Its IUPAC name is N-(1-benzofuran-2-yl)-2-(5-chloro-1-benzothiophen-3-yl)acetamide.
| Compound Name | N-(1-benzofuran-2-yl)-2-(5-chloro-1-benzothiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 90955606 |
| Molecular Formula | C18H12ClNO2S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-(1-benzofuran-2-yl)-2-(5-chloro-1-benzothiophen-3-yl)acetamide |
| SMILES | O=C(Cc1csc2ccc(Cl)cc12)Nc1cc2ccccc2o1 |
| InChI | InChI=1S/C18H12ClNO2S/c19-13-5-6-16-14(9-13)12(10-23-16)7-17(21)20-18-8-11-3-1-2-4-15(11)22-18/h1-6,8-10H,7H2,(H,20,21) |
| InChIKey | BKRRDNQJTWGCHN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |