C22H22ClNOS — CID 142027494
2-(5-chloro-1-benzothiophen-3-yl)-N-(4-cyclohexylphenyl)acetamide (PubChem CID 142027494) has the molecular formula C22H22ClNOS and a molecular weight of 383.94 g/mol. Its IUPAC name is 2-(5-chloro-1-benzothiophen-3-yl)-N-(4-cyclohexylphenyl)acetamide.
| Compound Name | 2-(5-chloro-1-benzothiophen-3-yl)-N-(4-cyclohexylphenyl)acetamide |
|---|---|
| PubChem CID | 142027494 |
| Molecular Formula | C22H22ClNOS |
| Molecular Weight | 383.94 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-(5-chloro-1-benzothiophen-3-yl)-N-(4-cyclohexylphenyl)acetamide |
| SMILES | O=C(Cc1csc2ccc(Cl)cc12)Nc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H22ClNOS/c23-18-8-11-21-20(13-18)17(14-26-21)12-22(25)24-19-9-6-16(7-10-19)15-4-2-1-3-5-15/h6-11,13-15H,1-5,12H2,(H,24,25) |
| InChIKey | FAAYVMDSMGSHLR-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.94 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |