C10H8ClNO2S — CID 23072664
(5-chloro-1-benzothiophen-3-yl)methylcarbamic acid (PubChem CID 23072664) has the molecular formula C10H8ClNO2S and a molecular weight of 241.70 g/mol. Its IUPAC name is (5-chloro-1-benzothiophen-3-yl)methylcarbamic acid.
| Compound Name | (5-chloro-1-benzothiophen-3-yl)methylcarbamic acid |
|---|---|
| PubChem CID | 23072664 |
| Molecular Formula | C10H8ClNO2S |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | (5-chloro-1-benzothiophen-3-yl)methylcarbamic acid |
| SMILES | O=C(O)NCc1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C10H8ClNO2S/c11-7-1-2-9-8(3-7)6(5-15-9)4-12-10(13)14/h1-3,5,12H,4H2,(H,13,14) |
| InChIKey | MGUUSOGKKDEHMO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |