C13H15ClS — CID 21014712
5-chloro-3-(2,2-dimethylpropyl)-1-benzothiophene (PubChem CID 21014712) has the molecular formula C13H15ClS and a molecular weight of 238.78 g/mol. Its IUPAC name is 5-chloro-3-(2,2-dimethylpropyl)-1-benzothiophene.
| Compound Name | 5-chloro-3-(2,2-dimethylpropyl)-1-benzothiophene |
|---|---|
| PubChem CID | 21014712 |
| Molecular Formula | C13H15ClS |
| Molecular Weight | 238.78 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 5-chloro-3-(2,2-dimethylpropyl)-1-benzothiophene |
| SMILES | CC(C)(C)Cc1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C13H15ClS/c1-13(2,3)7-9-8-15-12-5-4-10(14)6-11(9)12/h4-6,8H,7H2,1-3H3 |
| InChIKey | UEOLWVDNUIYXSA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |