C17H21ClN2OS — CID 50961311
2-[(5-chloro-1-benzothiophen-3-yl)methylamino]-N-cyclopentylpropanamide (PubChem CID 50961311) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is 2-[(5-chloro-1-benzothiophen-3-yl)methylamino]-N-cyclopentylpropanamide.
| Compound Name | 2-[(5-chloro-1-benzothiophen-3-yl)methylamino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 50961311 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[(5-chloro-1-benzothiophen-3-yl)methylamino]-N-cyclopentylpropanamide |
| SMILES | CC(NCc1csc2ccc(Cl)cc12)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H21ClN2OS/c1-11(17(21)20-14-4-2-3-5-14)19-9-12-10-22-16-7-6-13(18)8-15(12)16/h6-8,10-11,14,19H,2-5,9H2,1H3,(H,20,21) |
| InChIKey | TUUQCFRCJZZKCN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |