C19H32B2O4 — CID 102497694
2-[5,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenta-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102497694) has the molecular formula C19H32B2O4 and a molecular weight of 346.09 g/mol. Its IUPAC name is 2-[5,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenta-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[5,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenta-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102497694 |
| Molecular Formula | C19H32B2O4 |
| Molecular Weight | 346.09 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-[5,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenta-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)C(B2OC(C)(C)C(C)(C)O2)=CC=C1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H32B2O4/c1-15(2)13(20-22-16(3,4)17(5,6)23-20)11-12-14(15)21-24-18(7,8)19(9,10)25-21/h11-12H,1-10H3 |
| InChIKey | VHBRJZLJIIHNFT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.09 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|