C17H29BO2S — CID 143982261
4-ethyl-2-(3-hexylthiophen-2-yl)-4,5,5-trimethyl-1,3,2-dioxaborolane (PubChem CID 143982261) has the molecular formula C17H29BO2S and a molecular weight of 308.30 g/mol. Its IUPAC name is 4-ethyl-2-(3-hexylthiophen-2-yl)-4,5,5-trimethyl-1,3,2-dioxaborolane.
| Compound Name | 4-ethyl-2-(3-hexylthiophen-2-yl)-4,5,5-trimethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 143982261 |
| Molecular Formula | C17H29BO2S |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 4-ethyl-2-(3-hexylthiophen-2-yl)-4,5,5-trimethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCc1ccsc1B1OC(C)(C)C(C)(CC)O1 |
| InChI | InChI=1S/C17H29BO2S/c1-6-8-9-10-11-14-12-13-21-15(14)18-19-16(3,4)17(5,7-2)20-18/h12-13H,6-11H2,1-5H3 |
| InChIKey | VTVOQKBKQQMEME-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|