C11H18BO2P — CID 90048473
2-(1,2-dihydrophosphinin-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 90048473) has the molecular formula C11H18BO2P and a molecular weight of 224.05 g/mol. Its IUPAC name is 2-(1,2-dihydrophosphinin-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1,2-dihydrophosphinin-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90048473 |
| Molecular Formula | C11H18BO2P |
| Molecular Weight | 224.05 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-(1,2-dihydrophosphinin-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=CCPC=C2)OC1(C)C |
| InChI | InChI=1S/C11H18BO2P/c1-10(2)11(3,4)14-12(13-10)9-5-7-15-8-6-9/h5-7,15H,8H2,1-4H3 |
| InChIKey | OVMDSGCJJLWWEF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.05 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|