C14H24BNO2 — CID 135556156
N,N-dimethyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenta-1,3-dien-1-yl]methanamine (PubChem CID 135556156) has the molecular formula C14H24BNO2 and a molecular weight of 249.16 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenta-1,3-dien-1-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenta-1,3-dien-1-yl]methanamine |
|---|---|
| PubChem CID | 135556156 |
| Molecular Formula | C14H24BNO2 |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | N,N-dimethyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopenta-1,3-dien-1-yl]methanamine |
| SMILES | CN(C)CC1=C(B2OC(C)(C)C(C)(C)O2)C=CC1 |
| InChI | InChI=1S/C14H24BNO2/c1-13(2)14(3,4)18-15(17-13)12-9-7-8-11(12)10-16(5)6/h7,9H,8,10H2,1-6H3 |
| InChIKey | FYXFITIVRASCJM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|