C16H26B2O4S — CID 56973254
4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane (PubChem CID 56973254) has the molecular formula C16H26B2O4S and a molecular weight of 336.07 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 56973254 |
| Molecular Formula | C16H26B2O4S |
| Molecular Weight | 336.07 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2csc(B3OC(C)(C)C(C)(C)O3)c2)OC1(C)C |
| InChI | InChI=1S/C16H26B2O4S/c1-13(2)14(3,4)20-17(19-13)11-9-12(23-10-11)18-21-15(5,6)16(7,8)22-18/h9-10H,1-8H3 |
| InChIKey | GWFKRKWQGFBSEK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.07 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|