C14H17BO3S — CID 66520196
2-[4-(furan-2-yl)thiophen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 66520196) has the molecular formula C14H17BO3S and a molecular weight of 276.17 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)thiophen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(furan-2-yl)thiophen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 66520196 |
| Molecular Formula | C14H17BO3S |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[4-(furan-2-yl)thiophen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(-c3ccco3)cs2)OC1(C)C |
| InChI | InChI=1S/C14H17BO3S/c1-13(2)14(3,4)18-15(17-13)12-8-10(9-19-12)11-6-5-7-16-11/h5-9H,1-4H3 |
| InChIKey | SZTNMGWVXZKSIB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|