C13H22BNO2 — CID 155576911
2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-dihydropyridine (PubChem CID 155576911) has the molecular formula C13H22BNO2 and a molecular weight of 235.14 g/mol. Its IUPAC name is 2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-dihydropyridine.
| Compound Name | 2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 155576911 |
| Molecular Formula | C13H22BNO2 |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-dihydropyridine |
| SMILES | CC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(C)N1 |
| InChI | InChI=1S/C13H22BNO2/c1-9-7-8-11(10(2)15-9)14-16-12(3,4)13(5,6)17-14/h7-8,10,15H,1-6H3 |
| InChIKey | QTKVDASTYJLYPF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|