C14H23BO4 — CID 135393437
2-[(3aS,6aR)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 135393437) has the molecular formula C14H23BO4 and a molecular weight of 266.15 g/mol. Its IUPAC name is 2-[(3aS,6aR)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(3aS,6aR)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 135393437 |
| Molecular Formula | C14H23BO4 |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-[(3aS,6aR)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)O[C@@H]2CC=C(B3OC(C)(C)C(C)(C)O3)[C@@H]2O1 |
| InChI | InChI=1S/C14H23BO4/c1-12(2)13(3,4)19-15(18-12)9-7-8-10-11(9)17-14(5,6)16-10/h7,10-11H,8H2,1-6H3/t10-,11+/m1/s1 |
| InChIKey | PHJRIWACSOGBJR-MNOVXSKESA-N |
| XLogP | 2.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|