C16H23BClNO2 — CID 173482359
1-[(E)-2-chloroprop-1-enyl]-2-ethylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 173482359) has the molecular formula C16H23BClNO2 and a molecular weight of 307.63 g/mol. Its IUPAC name is 1-[(E)-2-chloroprop-1-enyl]-2-ethylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 1-[(E)-2-chloroprop-1-enyl]-2-ethylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 173482359 |
| Molecular Formula | C16H23BClNO2 |
| Molecular Weight | 307.63 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-[(E)-2-chloroprop-1-enyl]-2-ethylidene-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC=C1C=CC(B2OC(C)(C)C(C)(C)O2)=CN1/C=C(\C)Cl |
| InChI | InChI=1S/C16H23BClNO2/c1-7-14-9-8-13(11-19(14)10-12(2)18)17-20-15(3,4)16(5,6)21-17/h7-11H,1-6H3/b12-10+,14-7? |
| InChIKey | DWNYQOYOTURDJI-XQWYRQERSA-N |
| XLogP | 4.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|