C12H19BN4O2 — CID 153455133
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-triazolo[1,5-a]pyridin-2-amine (PubChem CID 153455133) has the molecular formula C12H19BN4O2 and a molecular weight of 262.12 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 153455133 |
| Molecular Formula | C12H19BN4O2 |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-triazolo[1,5-a]pyridin-2-amine |
| SMILES | CC1(C)OB(C2=CC3=CN(N)NN3C=C2)OC1(C)C |
| InChI | InChI=1S/C12H19BN4O2/c1-11(2)12(3,4)19-13(18-11)9-5-6-16-10(7-9)8-17(14)15-16/h5-8,15H,14H2,1-4H3 |
| InChIKey | QEFLCCROHHEHIJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|