C14H21BClNO3 — CID 174780510
[4-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine (PubChem CID 174780510) has the molecular formula C14H21BClNO3 and a molecular weight of 297.59 g/mol. Its IUPAC name is [4-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine.
| Compound Name | [4-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 174780510 |
| Molecular Formula | C14H21BClNO3 |
| Molecular Weight | 297.59 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [4-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
| SMILES | COc1cc(Cl)c(B2OC(C)(C)C(C)(C)O2)cc1CN |
| InChI | InChI=1S/C14H21BClNO3/c1-13(2)14(3,4)20-15(19-13)10-6-9(8-17)12(18-5)7-11(10)16/h6-7H,8,17H2,1-5H3 |
| InChIKey | PWKYUNWXMOZPJB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.59 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|