C18H36BNO3S — CID 145008141
tri(propan-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,3-oxazol-2-yl]-λ4-sulfane (PubChem CID 145008141) has the molecular formula C18H36BNO3S and a molecular weight of 357.37 g/mol. Its IUPAC name is tri(propan-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,3-oxazol-2-yl]-λ4-sulfane.
| Compound Name | tri(propan-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,3-oxazol-2-yl]-λ4-sulfane |
|---|---|
| PubChem CID | 145008141 |
| Molecular Formula | C18H36BNO3S |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | tri(propan-2-yl)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,3-oxazol-2-yl]-λ4-sulfane |
| SMILES | CC(C)S(C(C)C)(C(C)C)C1NC=C(B2OC(C)(C)C(C)(C)O2)O1 |
| InChI | InChI=1S/C18H36BNO3S/c1-12(2)24(13(3)4,14(5)6)16-20-11-15(21-16)19-22-17(7,8)18(9,10)23-19/h11-14,16,20H,1-10H3 |
| InChIKey | GRXYNFDUCXCLPM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|