C13H23BN2O4 — CID 123898207
ethyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate (PubChem CID 123898207) has the molecular formula C13H23BN2O4 and a molecular weight of 282.15 g/mol. Its IUPAC name is ethyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 123898207 |
| Molecular Formula | C13H23BN2O4 |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | ethyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
| SMILES | CCOC(=O)C1C=C(B2OC(C)(C)C(C)(C)O2)N(C)N1 |
| InChI | InChI=1S/C13H23BN2O4/c1-7-18-11(17)9-8-10(16(6)15-9)14-19-12(2,3)13(4,5)20-14/h8-9,15H,7H2,1-6H3 |
| InChIKey | YCWOMBRSPHTFPU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|