C41H40BN3O3 — CID 169131659
6-[2-ethyl-6-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 169131659) has the molecular formula C41H40BN3O3 and a molecular weight of 633.60 g/mol. Its IUPAC name is 6-[2-ethyl-6-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 6-[2-ethyl-6-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 169131659 |
| Molecular Formula | C41H40BN3O3 |
| Molecular Weight | 633.60 g/mol |
| Exact Mass | 633.32 |
| IUPAC Name | 6-[2-ethyl-6-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | CCc1cccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c1C1C=C(B2OC(C)(C)C(C)(C)O2)C=CC1O |
| InChI | InChI=1S/C41H40BN3O3/c1-6-27-18-13-19-33(36(27)34-26-32(24-25-35(34)46)42-47-40(2,3)41(4,5)48-42)39-44-37(30-16-11-8-12-17-30)43-38(45-39)31-22-20-29(21-23-31)28-14-9-7-10-15-28/h7-26,34-35,46H,6H2,1-5H3 |
| InChIKey | VXOGNFQJJLSJIV-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.60 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|