C39H32BN3O4 — CID 142474148
2-phenyl-4-(4-phenylphenyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzo-p-dioxin-1-yl]-1,3,5-triazine (PubChem CID 142474148) has the molecular formula C39H32BN3O4 and a molecular weight of 617.51 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzo-p-dioxin-1-yl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzo-p-dioxin-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 142474148 |
| Molecular Formula | C39H32BN3O4 |
| Molecular Weight | 617.51 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzo-p-dioxin-1-yl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccccc5)cc4)n3)c3c2Oc2ccccc2O3)OC1(C)C |
| InChI | InChI=1S/C39H32BN3O4/c1-38(2)39(3,4)47-40(46-38)30-24-23-29(33-34(30)45-32-18-12-11-17-31(32)44-33)37-42-35(27-15-9-6-10-16-27)41-36(43-37)28-21-19-26(20-22-28)25-13-7-5-8-14-25/h5-24H,1-4H3 |
| InChIKey | FVOKTSSNCCWYAM-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.51 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|