C31H34BN3O2 — CID 169296963
2-(2-tert-butylphenyl)-4-phenyl-6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 169296963) has the molecular formula C31H34BN3O2 and a molecular weight of 491.44 g/mol. Its IUPAC name is 2-(2-tert-butylphenyl)-4-phenyl-6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(2-tert-butylphenyl)-4-phenyl-6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 169296963 |
| Molecular Formula | C31H34BN3O2 |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 2-(2-tert-butylphenyl)-4-phenyl-6-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccccc1-c1nc(-c2ccccc2)nc(-c2ccccc2B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C31H34BN3O2/c1-29(2,3)24-19-13-11-17-22(24)27-33-26(21-15-9-8-10-16-21)34-28(35-27)23-18-12-14-20-25(23)32-36-30(4,5)31(6,7)37-32/h8-20H,1-7H3 |
| InChIKey | FZLIPEBBJVILJS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|