C15H17BClN3O2 — CID 171440348
2-chloro-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazine (PubChem CID 171440348) has the molecular formula C15H17BClN3O2 and a molecular weight of 317.59 g/mol. Its IUPAC name is 2-chloro-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171440348 |
| Molecular Formula | C15H17BClN3O2 |
| Molecular Weight | 317.59 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-chloro-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,5-triazine |
| SMILES | CC1(C)OB(c2nc(Cl)nc(-c3ccccc3)n2)OC1(C)C |
| InChI | InChI=1S/C15H17BClN3O2/c1-14(2)15(3,4)22-16(21-14)12-18-11(19-13(17)20-12)10-8-6-5-7-9-10/h5-9H,1-4H3 |
| InChIKey | XMFQJGWPKZLGIA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|