C33H29BClN3O2 — CID 140829023
2-[4-[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 140829023) has the molecular formula C33H29BClN3O2 and a molecular weight of 545.88 g/mol. Its IUPAC name is 2-[4-[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 140829023 |
| Molecular Formula | C33H29BClN3O2 |
| Molecular Weight | 545.88 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 2-[4-[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc(Cl)cc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)OC1(C)C |
| InChI | InChI=1S/C33H29BClN3O2/c1-32(2)33(3,4)40-34(39-32)28-20-19-26(35)21-27(28)22-15-17-25(18-16-22)31-37-29(23-11-7-5-8-12-23)36-30(38-31)24-13-9-6-10-14-24/h5-21H,1-4H3 |
| InChIKey | PLLSUGOAJDIFNX-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.88 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|