C15H23BN2O2 — CID 143103053
2-propanimidoyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 143103053) has the molecular formula C15H23BN2O2 and a molecular weight of 274.17 g/mol. Its IUPAC name is 2-propanimidoyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 2-propanimidoyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 143103053 |
| Molecular Formula | C15H23BN2O2 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-propanimidoyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | [H]/N=C(\CC)c1cc(B2OC(C)(C)C(C)(C)O2)ccc1N |
| InChI | InChI=1S/C15H23BN2O2/c1-6-12(17)11-9-10(7-8-13(11)18)16-19-14(2,3)15(4,5)20-16/h7-9,17H,6,18H2,1-5H3/b17-12+ |
| InChIKey | DYDPIVPEKSCZOL-SFQUDFHCSA-N |
| XLogP | 2.35 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|