C15H22BN3O3 — CID 156720399
2-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-imino-N-methylacetamide (PubChem CID 156720399) has the molecular formula C15H22BN3O3 and a molecular weight of 303.17 g/mol. Its IUPAC name is 2-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-imino-N-methylacetamide.
| Compound Name | 2-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-imino-N-methylacetamide |
|---|---|
| PubChem CID | 156720399 |
| Molecular Formula | C15H22BN3O3 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-[2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-imino-N-methylacetamide |
| SMILES | [H]/N=C(\C(=O)NC)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1N |
| InChI | InChI=1S/C15H22BN3O3/c1-14(2)15(3,4)22-16(21-14)9-6-7-10(11(17)8-9)12(18)13(20)19-5/h6-8,18H,17H2,1-5H3,(H,19,20)/b18-12- |
| InChIKey | JBXMLWCBJNEPDZ-PDGQHHTCSA-N |
| XLogP | 0.68 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|