C19H23BN2O4 — CID 69012650
(3,5-diaminophenyl)-[2-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 69012650) has the molecular formula C19H23BN2O4 and a molecular weight of 354.22 g/mol. Its IUPAC name is (3,5-diaminophenyl)-[2-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | (3,5-diaminophenyl)-[2-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 69012650 |
| Molecular Formula | C19H23BN2O4 |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (3,5-diaminophenyl)-[2-hydroxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)c3cc(N)cc(N)c3)c(O)c2)OC1(C)C |
| InChI | InChI=1S/C19H23BN2O4/c1-18(2)19(3,4)26-20(25-18)12-5-6-15(16(23)9-12)17(24)11-7-13(21)10-14(22)8-11/h5-10,23H,21-22H2,1-4H3 |
| InChIKey | AIGYHPVDIJNPAK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|