C21H31BN2O5 — CID 163722524
tert-butyl 2-[2-(2-oxopropanimidoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]acetate (PubChem CID 163722524) has the molecular formula C21H31BN2O5 and a molecular weight of 402.30 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-oxopropanimidoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]acetate.
| Compound Name | tert-butyl 2-[2-(2-oxopropanimidoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]acetate |
|---|---|
| PubChem CID | 163722524 |
| Molecular Formula | C21H31BN2O5 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | tert-butyl 2-[2-(2-oxopropanimidoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]acetate |
| SMILES | [H]/N=C(\C(C)=O)c1cc(B2OC(C)(C)C(C)(C)O2)ccc1NCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31BN2O5/c1-13(25)18(23)15-11-14(22-28-20(5,6)21(7,8)29-22)9-10-16(15)24-12-17(26)27-19(2,3)4/h9-11,23-24H,12H2,1-8H3/b23-18+ |
| InChIKey | KSUDNYATDANODJ-PTGBLXJZSA-N |
| XLogP | 2.70 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|