C21H32BN3O5 — CID 156650963
tert-butyl N-[(2E)-2-[2-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(methylhydrazinylidene)ethyl]carbamate (PubChem CID 156650963) has the molecular formula C21H32BN3O5 and a molecular weight of 417.32 g/mol. Its IUPAC name is tert-butyl N-[(2E)-2-[2-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(methylhydrazinylidene)ethyl]carbamate.
| Compound Name | tert-butyl N-[(2E)-2-[2-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(methylhydrazinylidene)ethyl]carbamate |
|---|---|
| PubChem CID | 156650963 |
| Molecular Formula | C21H32BN3O5 |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | tert-butyl N-[(2E)-2-[2-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(methylhydrazinylidene)ethyl]carbamate |
| SMILES | CN/N=C(/CNC(=O)OC(C)(C)C)c1cc(B2OC(C)(C)C(C)(C)O2)ccc1C=O |
| InChI | InChI=1S/C21H32BN3O5/c1-19(2,3)28-18(27)24-12-17(25-23-8)16-11-15(10-9-14(16)13-26)22-29-20(4,5)21(6,7)30-22/h9-11,13,23H,12H2,1-8H3,(H,24,27)/b25-17- |
| InChIKey | HYOFILMBMURPRC-UQQQWYQISA-N |
| XLogP | 2.25 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|