C28H36BN3O6 — CID 174070497
tert-butyl N-[[2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-3-yl]oxyethoxy]-4-pyridinyl]methyl]carbamate (PubChem CID 174070497) has the molecular formula C28H36BN3O6 and a molecular weight of 521.42 g/mol. Its IUPAC name is tert-butyl N-[[2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-3-yl]oxyethoxy]-4-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-3-yl]oxyethoxy]-4-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 174070497 |
| Molecular Formula | C28H36BN3O6 |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | tert-butyl N-[[2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-3-yl]oxyethoxy]-4-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccnc(OCCOc2cnc3ccc(B4OC(C)(C)C(C)(C)O4)cc3c2)c1 |
| InChI | InChI=1S/C28H36BN3O6/c1-26(2,3)36-25(33)32-17-19-10-11-30-24(14-19)35-13-12-34-22-16-20-15-21(8-9-23(20)31-18-22)29-37-27(4,5)28(6,7)38-29/h8-11,14-16,18H,12-13,17H2,1-7H3,(H,32,33) |
| InChIKey | XVSPHLPKLWACTH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|