C21H34BNO2 — CID 145349047
butane;(1Z)-3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]buta-1,3-dien-1-amine (PubChem CID 145349047) has the molecular formula C21H34BNO2 and a molecular weight of 343.32 g/mol. Its IUPAC name is butane;(1Z)-3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]buta-1,3-dien-1-amine.
| Compound Name | butane;(1Z)-3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145349047 |
| Molecular Formula | C21H34BNO2 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | butane;(1Z)-3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]buta-1,3-dien-1-amine |
| SMILES | C=C(/C=C\N)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1C.CCCC |
| InChI | InChI=1S/C17H24BNO2.C4H10/c1-12(9-10-19)15-8-7-14(11-13(15)2)18-20-16(3,4)17(5,6)21-18;1-3-4-2/h7-11H,1,19H2,2-6H3;3-4H2,1-2H3/b10-9-; |
| InChIKey | QGWKYAQDXCQRQB-KVVVOXFISA-N |
| XLogP | 4.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|