C39H52B2O5 — CID 123970914
2-ethyl-4-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-phenylpent-4-en-1-ol (PubChem CID 123970914) has the molecular formula C39H52B2O5 and a molecular weight of 622.46 g/mol. Its IUPAC name is 2-ethyl-4-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-phenylpent-4-en-1-ol.
| Compound Name | 2-ethyl-4-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-phenylpent-4-en-1-ol |
|---|---|
| PubChem CID | 123970914 |
| Molecular Formula | C39H52B2O5 |
| Molecular Weight | 622.46 g/mol |
| Exact Mass | 622.40 |
| IUPAC Name | 2-ethyl-4-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-phenylpent-4-en-1-ol |
| SMILES | CCC(CC(=Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1C)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1C)C(O)c1ccccc1 |
| InChI | InChI=1S/C39H52B2O5/c1-12-28(35(42)29-16-14-13-15-17-29)23-31(34-21-20-32(22-27(34)3)40-43-36(4,5)37(6,7)44-40)24-30-25-33(19-18-26(30)2)41-45-38(8,9)39(10,11)46-41/h13-22,24-25,28,35,42H,12,23H2,1-11H3 |
| InChIKey | GTECOGVLNSHPRZ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.46 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|