C16H26BNO4 — CID 171882295
4-amino-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,2-diol (PubChem CID 171882295) has the molecular formula C16H26BNO4 and a molecular weight of 307.20 g/mol. Its IUPAC name is 4-amino-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,2-diol.
| Compound Name | 4-amino-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171882295 |
| Molecular Formula | C16H26BNO4 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 4-amino-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butane-1,2-diol |
| SMILES | CC1(C)OB(c2cccc(C(O)C(O)CCN)c2)OC1(C)C |
| InChI | InChI=1S/C16H26BNO4/c1-15(2)16(3,4)22-17(21-15)12-7-5-6-11(10-12)14(20)13(19)8-9-18/h5-7,10,13-14,19-20H,8-9,18H2,1-4H3 |
| InChIKey | VUEQKGWCAVRGFJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|