C40H58BBrO10 — CID 158602733
5-O-tert-butyl 1-O-ethyl (3R)-3-(3-bromophenyl)pentanedioate;5-O-tert-butyl 1-O-ethyl (3R)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanedioate (PubChem CID 158602733) has the molecular formula C40H58BBrO10 and a molecular weight of 789.61 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-ethyl (3R)-3-(3-bromophenyl)pentanedioate;5-O-tert-butyl 1-O-ethyl (3R)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-ethyl (3R)-3-(3-bromophenyl)pentanedioate;5-O-tert-butyl 1-O-ethyl (3R)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanedioate |
|---|---|
| PubChem CID | 158602733 |
| Molecular Formula | C40H58BBrO10 |
| Molecular Weight | 789.61 g/mol |
| Exact Mass | 788.33 |
| IUPAC Name | 5-O-tert-butyl 1-O-ethyl (3R)-3-(3-bromophenyl)pentanedioate;5-O-tert-butyl 1-O-ethyl (3R)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanedioate |
| SMILES | CCOC(=O)C[C@H](CC(=O)OC(C)(C)C)c1cccc(B2OC(C)(C)C(C)(C)O2)c1.CCOC(=O)C[C@H](CC(=O)OC(C)(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H35BO6.C17H23BrO4/c1-9-27-19(25)14-17(15-20(26)28-21(2,3)4)16-11-10-12-18(13-16)24-29-22(5,6)23(7,8)30-24;1-5-21-15(19)10-13(11-16(20)22-17(2,3)4)12-7-6-8-14(18)9-12/h10-13,17H,9,14-15H2,1-8H3;6-9,13H,5,10-11H2,1-4H3/t17-;13-/m11/s1 |
| InChIKey | HVVOELQLPJCHQL-GFJIOCRJSA-N |
| XLogP | 7.97 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.61 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|