C17H26BNO4 — CID 163198816
2-[3-(2,2-dimethyl-1-nitropropyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 163198816) has the molecular formula C17H26BNO4 and a molecular weight of 319.21 g/mol. Its IUPAC name is 2-[3-(2,2-dimethyl-1-nitropropyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(2,2-dimethyl-1-nitropropyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 163198816 |
| Molecular Formula | C17H26BNO4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-[3-(2,2-dimethyl-1-nitropropyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)C(c1cccc(B2OC(C)(C)C(C)(C)O2)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C17H26BNO4/c1-15(2,3)14(19(20)21)12-9-8-10-13(11-12)18-22-16(4,5)17(6,7)23-18/h8-11,14H,1-7H3 |
| InChIKey | ZZCZFBLEYROAKD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|