C19H21BN2O4 — CID 10915147
1-(4-nitrophenyl)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (PubChem CID 10915147) has the molecular formula C19H21BN2O4 and a molecular weight of 352.20 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine.
| Compound Name | 1-(4-nitrophenyl)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 10915147 |
| Molecular Formula | C19H21BN2O4 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-(4-nitrophenyl)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| SMILES | CC1(C)OB(c2cccc(/N=C/c3ccc([N+](=O)[O-])cc3)c2)OC1(C)C |
| InChI | InChI=1S/C19H21BN2O4/c1-18(2)19(3,4)26-20(25-18)15-6-5-7-16(12-15)21-13-14-8-10-17(11-9-14)22(23)24/h5-13H,1-4H3/b21-13+ |
| InChIKey | LFEOJPAVUDGHRZ-FYJGNVAPSA-N |
| XLogP | 3.64 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|