C20H22BNO5 — CID 177457171
4-nitro-2-[(Z)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenol (PubChem CID 177457171) has the molecular formula C20H22BNO5 and a molecular weight of 367.21 g/mol. Its IUPAC name is 4-nitro-2-[(Z)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenol.
| Compound Name | 4-nitro-2-[(Z)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 177457171 |
| Molecular Formula | C20H22BNO5 |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 4-nitro-2-[(Z)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]phenol |
| SMILES | CC1(C)OB(c2ccc(/C=C\c3cc([N+](=O)[O-])ccc3O)cc2)OC1(C)C |
| InChI | InChI=1S/C20H22BNO5/c1-19(2)20(3,4)27-21(26-19)16-9-6-14(7-10-16)5-8-15-13-17(22(24)25)11-12-18(15)23/h5-13,23H,1-4H3/b8-5- |
| InChIKey | BOEHEMUDUQRSES-YVMONPNESA-N |
| XLogP | 3.77 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|