C16H15NO5 — CID 118720095
2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4-nitrophenol (PubChem CID 118720095) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4-nitrophenol.
| Compound Name | 2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4-nitrophenol |
|---|---|
| PubChem CID | 118720095 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4-nitrophenol |
| SMILES | COc1cc(/C=C/c2cc([N+](=O)[O-])ccc2O)cc(OC)c1 |
| InChI | InChI=1S/C16H15NO5/c1-21-14-7-11(8-15(10-14)22-2)3-4-12-9-13(17(19)20)5-6-16(12)18/h3-10,18H,1-2H3/b4-3+ |
| InChIKey | XNJOFVCCJSMNSI-ONEGZZNKSA-N |
| XLogP | 3.49 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|