C14H9ClN2O5 — CID 6083825
4-chloro-2-[(E)-2-(2,4-dinitrophenyl)ethenyl]phenol (PubChem CID 6083825) has the molecular formula C14H9ClN2O5 and a molecular weight of 320.69 g/mol. Its IUPAC name is 4-chloro-2-[(E)-2-(2,4-dinitrophenyl)ethenyl]phenol.
| Compound Name | 4-chloro-2-[(E)-2-(2,4-dinitrophenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 6083825 |
| Molecular Formula | C14H9ClN2O5 |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-chloro-2-[(E)-2-(2,4-dinitrophenyl)ethenyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2cc(Cl)ccc2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9ClN2O5/c15-11-4-6-14(18)10(7-11)2-1-9-3-5-12(16(19)20)8-13(9)17(21)22/h1-8,18H/b2-1+ |
| InChIKey | KMRRNHLOEVIPRB-OWOJBTEDSA-N |
| XLogP | 4.03 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|